1. Home/
  2. Compounds/
  3. tamatinib

tamatinib

Synonyms

SourcesNames Used
CTRPv2tamatinib
PharmacoGx tamatinib

External IDs

DatabaseIdentifier
Smiles: CC1(C(=O)NC2=C(O1)C=CC(=N2)NC3=NC(=NC=C3F)NC4=CC(=C(C(=C4)OC)OC)OC)C
Inchikey: NHHQJBCNYHBUSI-UHFFFAOYSA-N
Pubchem: 11213558

Annotated Targets

SYK

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to tamatinib


Feature TypeStandardized
Nominal ANOVA
Download CSV