1. Home/
  2. Compounds/
  3. ruxolitinib

ruxolitinib

Synonyms

SourcesNames Used
GDSC1000Ruxolitinib
CTRPv2ruxolitinib
PharmacoGx ruxolitinib

External IDs

DatabaseIdentifier
Smiles: N#CC[C@H](C1CCCC1)n1cc(cn1)-c1ncnc2[nH]ccc12
Pubchem: 25126798

Annotated Targets

JAK2, JAK1, JAK3, TYK2

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to ruxolitinib


Feature TypeStandardized
Nominal ANOVA
Download CSV