1. Home/
  2. Compounds/
  3. BMS-509744

BMS-509744

Synonyms

SourcesNames Used
GDSC1000BMS-509744
PharmacoGx BMS-509744

External IDs

DatabaseIdentifier
Smiles: CC1=C(C=C(C(=C1)OC)C(=O)N2CCN(CC2)C(=O)C)SC3=CN=C(S3)NC(=O)C4=CC=C(C=C4)CNC(C)C(C)(C)C
Inchikey: ZHXNIYGJAOPMSO-UHFFFAOYSA-N
Pubchem: 11467730

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to BMS-509744


Feature TypeStandardized
Nominal ANOVA
Download CSV