1. Home/
  2. Compounds/
  3. blebbistatin

blebbistatin

Synonyms

SourcesNames Used
CTRPv2blebbistatin
PharmacoGx blebbistatin

External IDs

DatabaseIdentifier
Smiles: CC1=CC2=C(C=C1)N=C3C(C2=O)(CCN3C4=CC=CC=C4)O
Inchikey: LZAXPYOBKSJSEX-UHFFFAOYSA-N
Pubchem: 3476986

Annotated Targets

MYH1, MYH2

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to blebbistatin


Feature TypeStandardized
Nominal ANOVA
Download CSV