1. Home/
  2. Compounds/
  3. Vinorelbine

Vinorelbine

Synonyms

SourcesNames Used
GDSC1000, GRAYVinorelbine
PharmacoGx Vinorelbine

External IDs

DatabaseIdentifier
Smiles: CCC1=CC2CC(C3=C(CN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC.C(C(C(=O)O)O)(C(=O)O)O
Inchikey: UUHYRRXICWUZHW-RPZOAHRESA-N
Pubchem: 25136944

Annotated Targets

TUBA1A, TUBA1B, TUBA1C, TUBA3C, TUBA3D, TUBA3E, TUBA4A, TUBB, TUBB1, TUBB2A, TUBB2B, TUBB3, TUBB4A, TUBB4B, TUBB6, TUBB8

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to Vinorelbine


Feature TypeStandardized
Nominal ANOVA
Download CSV