1. Home/
  2. Compounds/
  3. betulinic acid

betulinic acid

Synonyms

SourcesNames Used
CTRPv2betulinic acid
PharmacoGx betulinic acid

External IDs

DatabaseIdentifier
Smiles: CC(=C)[C@@H]1CC[C@@]2(CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12)C(=O)O
Inchikey: QGJZLNKBHJESQX-FZFNOLFKSA-N
Pubchem: 64971

Annotated Targets

GPBAR1

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to betulinic acid


Feature TypeStandardized
Nominal ANOVA
Download CSV