1. Home/
  2. Compounds/
  3. Topotecan

Topotecan

Synonyms

SourcesNames Used
CCLE, GRAY, FIMMTopotecan
CTRPv2topotecan
PharmacoGx Topotecan

External IDs

DatabaseIdentifier
Smiles: CCC1(C2=C(COC1=O)C(=O)N3CC4=C(C3=C2)[NH+]=C5C=CC(=C(C5=C4)CN(C)C)O)O.[Cl-]
Inchikey: DGHHQBMTXTWTJV-BQAIUKQQSA-N
Pubchem: 11972519

Annotated Targets

TOP1MT, TOP1

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to Topotecan


Feature TypeStandardized
Nominal ANOVA
Download CSV