1. Home/
  2. Compounds/
  3. thalidomide

thalidomide

Synonyms

SourcesNames Used
CTRPv2thalidomide
PharmacoGx thalidomide

External IDs

DatabaseIdentifier
Smiles: O=C1N(C2CCC(=O)NC2=O)C(=O)c3ccccc13
Inchikey: UEJJHQNACJXSKW-UHFFFAOYSA-N
Pubchem: 5426

Annotated Targets

CRBN, FGFR2, NFKB1, ORM1, ORM2, PTGS2, TNF

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to thalidomide


Feature TypeStandardized
Nominal ANOVA
Download CSV