1. Home/
  2. Compounds/
  3. temsirolimus

temsirolimus

Synonyms

SourcesNames Used
GDSC1000, GRAY, FIMMTemsirolimus
CTRPv2temsirolimus
PharmacoGx temsirolimus

External IDs

DatabaseIdentifier
Smiles: CC1CCC2CC(C(=CC=CC=CC(CC(C(=O)C(C(C(=CC(C(=O)CC(OC(=O)C3CCCCN3C(=O)C(=O)C1(O2)O)C(C)CC4CCC(C(C4)OC)OC(=O)C(C)(CO)CO)C)C)O)OC)C)C)C)OC
Inchikey: CBPNZQVSJQDFBE-FUXHJELOSA-N
Pubchem: 6918289

Annotated Targets

MTOR

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to temsirolimus


Feature TypeStandardized
Nominal ANOVA
Download CSV