1. Home/
  2. Compounds/
  3. BEC

BEC

Synonyms

SourcesNames Used
CTRPv2BEC
PharmacoGx BEC

External IDs

DatabaseIdentifier
Smiles: CC1=C(C(C(=C(N1)C)C(=O)OCC(=O)C)C2=CC=CC=C2[N+](=O)[O-])C(=O)OC
Inchikey: NCUCGYYHUFIYNU-UHFFFAOYSA-N
Pubchem: 2225

Annotated Targets

ARG1, ARG2

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to BEC


Feature TypeStandardized
Nominal ANOVA
Download CSV