1. Home/
  2. Compounds/
  3. Sunitinib

Sunitinib

Synonyms

SourcesNames Used
GDSC1000, FIMMSunitinib
CTRPv2sunitinib
PharmacoGx Sunitinib

External IDs

DatabaseIdentifier
Smiles: CCN(CC)CCNC(=O)C1=C(NC(=C1C)C=C2C3=C(C=CC(=C3)F)NC2=O)C
Inchikey: WINHZLLDWRZWRT-ATVHPVEESA-N
Pubchem: 5329102

Annotated Targets

CSF1R, KIT, FLT1, FLT3, KDR, PDGFRA, PDGFRB, FLT4

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to Sunitinib


Feature TypeStandardized
Nominal ANOVA
Download CSV