1. Home/
  2. Compounds/
  3. sitagliptin

sitagliptin

Synonyms

SourcesNames Used
CTRPv2sitagliptin
PharmacoGx sitagliptin

External IDs

DatabaseIdentifier
Smiles: N[C@@H](CC(=O)N1CCn2c(nnc2C1)C(F)(F)F)Cc3cc(F)c(F)cc3F
Pubchem: 4369359

Annotated Targets

DPP4

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to sitagliptin


Feature TypeStandardized
Nominal ANOVA
Download CSV