1. Home/
  2. Compounds/
  3. 5-FdUR

5-FdUR

Synonyms

SourcesNames Used
GRAY5-FdUR
PharmacoGx 5-FdUR

External IDs

DatabaseIdentifier
Smiles: C1C(C(OC1N2C=C(C(=O)NC2=O)F)CO)O
Inchikey: ODKNJVUHOIMIIZ-RRKCRQDMSA-N
Pubchem: 5790

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to 5-FdUR


Feature TypeStandardized
Nominal ANOVA
Download CSV