1. Home/
  2. Compounds/
  3. RITA

RITA

Synonyms

SourcesNames Used
CTRPv2RITA
PharmacoGx RITA

External IDs

DatabaseIdentifier
Smiles: C1=C(SC(=C1)C2=CC=C(O2)C3=CC=C(S3)CO)CO
Inchikey: KZENBFUSKMWCJF-UHFFFAOYSA-N
Pubchem: 374536

Annotated Targets

MDM2, TP53

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to RITA


Feature TypeStandardized
Nominal ANOVA
Download CSV