1. Home/
  2. Compounds/
  3. pifithrin-alpha

pifithrin-alpha

Synonyms

SourcesNames Used
CTRPv2pifithrin-alpha
PharmacoGx pifithrin-alpha

External IDs

DatabaseIdentifier
Smiles: CC1=CC=C(C=C1)C(=O)C[N+]2=C(SC3=C2CCCC3)N.[Br-]
Inchikey: HAGVCKULCLQGRF-UHFFFAOYSA-N
Pubchem: 57458948

Annotated Targets

TP53

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to pifithrin-alpha


Feature TypeStandardized
Nominal ANOVA
Download CSV