1. Home/
  2. Compounds/
  3. PD-0332991

PD-0332991

Synonyms

SourcesNames Used
CCLE, GDSC1000PD-0332991
FIMMPalbociclib
PharmacoGx PD-0332991

External IDs

DatabaseIdentifier
Smiles: CC1=C(C(=O)N(C2=NC(=NC=C12)NC3=NC=C(C=C3)N4CCNCC4)C5CCCC5)C(=O)C
Inchikey: AHJRHEGDXFFMBM-UHFFFAOYSA-N
Pubchem: 5330286

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to PD-0332991


Feature TypeStandardized
Nominal ANOVA
Download CSV