1. Home/
  2. Compounds/
  3. azacitidine

azacitidine

Synonyms

SourcesNames Used
CTRPv2azacitidine
PharmacoGx azacitidine

External IDs

DatabaseIdentifier
Smiles: Nc1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1
Inchikey: NMUSYJAQQFHJEW-KVTDHHQDSA-N
Pubchem: 9444

Annotated Targets

DNMT3A, DNMT1

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to azacitidine


Feature TypeStandardized
Nominal ANOVA
Download CSV