1. Home/
  2. Compounds/
  3. AT7867

AT7867

Synonyms

SourcesNames Used
CTRPv2AT7867
PharmacoGx AT7867

External IDs

DatabaseIdentifier
Smiles: Clc1ccc(cc1)C1(CCNCC1)c1ccc(cc1)-c1cn[nH]c1
Pubchem: 11175137

Annotated Targets

AKT2, GSK3B, PKIA, PRKACA, AKT1, AKT3, RPS6KB2

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to AT7867


Feature TypeStandardized
Nominal ANOVA
Download CSV