1. Home/
  2. Compounds/
  3. AS-252424

AS-252424

Synonyms

SourcesNames Used
GRAYAS-252424
PharmacoGx AS-252424

External IDs

DatabaseIdentifier
Smiles: C1=CC(=C(C=C1F)O)C2=CC=C(O2)C=C3C(=O)NC(=O)S3
Inchikey: OYYVWNDMOQPMGE-SDQBBNPISA-N
Pubchem: 11630874

Annotated Targets

PIK3CG

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to AS-252424


Feature TypeStandardized
Nominal ANOVA
Download CSV