1. Home/
  2. Compounds/
  3. AICAR

AICAR

Synonyms

SourcesNames Used
GDSC1000AICAR
PharmacoGx AICAR

External IDs

DatabaseIdentifier
Smiles: C1=NC(=C(N1C2C(C(C(O2)CO)O)O)N)C(=O)N
Inchikey: RTRQQBHATOEIAF-UUOKFMHZSA-N
Pubchem: 17513

Annotated Targets

ATIC

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to AICAR


Feature TypeStandardized
Nominal ANOVA
Download CSV