1. Home/
  2. Compounds/
  3. Crizotinib

Crizotinib

Synonyms

SourcesNames Used
CCLE, GRAYPF-2341066
GDSC1000, FIMMCrizotinib
gCSI, CTRPv2crizotinib
PharmacoGx Crizotinib

External IDs

DatabaseIdentifier
Smiles: CC(C1=C(C=C(C=C1Cl)F)Cl)OC2=C(N=CC(=C2)C3=CN(N=C3)C4CCNCC4)N
Inchikey: SCJHEFQWKWHQTO-GFCCVEGCSA-N
Pubchem: 54613769

Annotated Targets

MET, ALK

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to Crizotinib


Feature TypeStandardized
Nominal ANOVA
Download CSV