1. Home/
  2. Compounds/
  3. AGK-2

AGK-2

Synonyms

SourcesNames Used
CTRPv2AGK-2
PharmacoGx AGK-2

External IDs

DatabaseIdentifier
Smiles: C1=CC2=C(C=CC=N2)C(=C1)NC(=O)C(=CC3=CC=C(O3)C4=C(C=CC(=C4)Cl)Cl)C#N
Inchikey: SVENPFFEMUOOGK-SDNWHVSQSA-N
Pubchem: 2130404

Annotated Targets

SIRT2

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to AGK-2


Feature TypeStandardized
Nominal ANOVA
Download CSV