1. Home/
  2. Compounds/
  3. AC55649

AC55649

Synonyms

SourcesNames Used
CTRPv2AC55649
PharmacoGx AC55649

External IDs

DatabaseIdentifier
Smiles: CCCCCCCCC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O
Inchikey: HXBKPYIEQLLNBK-UHFFFAOYSA-N
Pubchem: 1714884

Annotated Targets

RARA, RARB

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to AC55649


Feature TypeStandardized
Nominal ANOVA
Download CSV