1. Home/
  2. Compounds/
  3. ABT-737

ABT-737

Synonyms

SourcesNames Used
CTRPv2ABT-737
PharmacoGx ABT-737

External IDs

DatabaseIdentifier
Smiles: CN(C)CCC(CSC1=CC=CC=C1)NC2=C(C=C(C=C2)S(=O)(=O)NC(=O)C3=CC=C(C=C3)N4CCN(CC4)CC5=CC=CC=C5C6=CC=C(C=C6)Cl)[N+](=O)[O-]
Inchikey: HPLNQCPCUACXLM-PGUFJCEWSA-N
Pubchem: 11228183

Annotated Targets

BCL2, BCL2L1, BCL2L2

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to ABT-737


Feature TypeStandardized
Nominal ANOVA
Download CSV