1. Home/
  2. Compounds/
  3. AA-COCF3

AA-COCF3

Synonyms

SourcesNames Used
CTRPv2AA-COCF3
PharmacoGx AA-COCF3

External IDs

DatabaseIdentifier
Smiles: CCCCCC=CCC=CCC=CCC=CCCCC(=O)C(F)(F)F
Inchikey: PLWROONZUDKYKG-DOFZRALJSA-N
Pubchem: 5280436

Annotated Targets

FAAH, PLA2G4A, PLA2G4B, PLA2G4C, PLA2G4D

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to AA-COCF3


Feature TypeStandardized
Nominal ANOVA
Download CSV