1. Home/
  2. Compounds/
  3. A-770041



SourcesNames Used
PharmacoGx A-770041

External IDs

Smiles: CC(=O)N1CCN(CC1)C2CCC(CC2)N3C4=C(C(=N3)C5=CC(=C(C=C5)NC(=O)C6=CC7=CC=CC=C7N6C)OC)C(=NC=N4)N
Pubchem: 9549184

FDA Approval Status

Dataset Select
Download Data as CSV

Top molecular features associated with response to A-770041

Feature TypeStandardized
Nominal ANOVA
Download CSV