1. Home/
  2. Compounds/
  3. BRD-K13999467

BRD-K13999467

Synonyms

SourcesNames Used
CTRPv2BRD-K13999467
PharmacoGx BRD-K13999467

External IDs

DatabaseIdentifier
Smiles: C[C@@H](CO)N1C[C@H](C)[C@H](CN(C)C(=O)Cc2ccncc2)Oc3cc(C#Cc4ccccc4F)ccc3S1(=O)=O

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to BRD-K13999467


Feature TypeStandardized
Nominal ANOVA
Download CSV