1. Home/
  2. Compounds/
  3. BRD-K02492147

BRD-K02492147

Synonyms

SourcesNames Used
CTRPv2BRD-K02492147
PharmacoGx BRD-K02492147

External IDs

DatabaseIdentifier
Smiles: CN1CCN(CC1)C(=O)C[C@@H]1O[C@H](CO)[C@@H](NS(=O)(=O)c2cccc(F)c2)C=C1

FDA Approval Status

Approved
Dataset Select
Download Data as CSV

Top molecular features associated with response to BRD-K02492147


Feature TypeStandardized
Nominal ANOVA
Download CSV